C14H16N4O2 — CID 5412984
(Z)-1,4-bis(3,5-dimethylpyrazol-1-yl)but-2-ene-1,4-dione (PubChem CID 5412984) has the molecular formula C14H16N4O2 and a molecular weight of 272.31 g/mol. Its IUPAC name is (Z)-1,4-bis(3,5-dimethylpyrazol-1-yl)but-2-ene-1,4-dione.
| Compound Name | (Z)-1,4-bis(3,5-dimethylpyrazol-1-yl)but-2-ene-1,4-dione |
|---|---|
| PubChem CID | 5412984 |
| Molecular Formula | C14H16N4O2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | (Z)-1,4-bis(3,5-dimethylpyrazol-1-yl)but-2-ene-1,4-dione |
| SMILES | Cc1cc(C)n(C(=O)/C=C\C(=O)n2nc(C)cc2C)n1 |
| InChI | InChI=1S/C14H16N4O2/c1-9-7-11(3)17(15-9)13(19)5-6-14(20)18-12(4)8-10(2)16-18/h5-8H,1-4H3/b6-5- |
| InChIKey | TXUYUWUEUSYNSC-WAYWQWQTSA-N |
| XLogP | 1.85 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|