C6H9N3S — CID 706477
3,5-dimethylpyrazole-1-carbothioamide (PubChem CID 706477) has the molecular formula C6H9N3S and a molecular weight of 155.23 g/mol. Its IUPAC name is 3,5-dimethylpyrazole-1-carbothioamide.
| Compound Name | 3,5-dimethylpyrazole-1-carbothioamide |
|---|---|
| PubChem CID | 706477 |
| Molecular Formula | C6H9N3S |
| Molecular Weight | 155.23 g/mol |
| Exact Mass | 155.05 |
| IUPAC Name | 3,5-dimethylpyrazole-1-carbothioamide |
| SMILES | Cc1cc(C)n(C(N)=S)n1 |
| InChI | InChI=1S/C6H9N3S/c1-4-3-5(2)9(8-4)6(7)10/h3H,1-2H3,(H2,7,10) |
| InChIKey | UUYLYTKDJRJZFC-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.23 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|