C14H20N4O — CID 102166636
1,4-bis(3,5-dimethylpyrazol-1-yl)butan-1-one (PubChem CID 102166636) has the molecular formula C14H20N4O and a molecular weight of 260.34 g/mol. Its IUPAC name is 1,4-bis(3,5-dimethylpyrazol-1-yl)butan-1-one.
| Compound Name | 1,4-bis(3,5-dimethylpyrazol-1-yl)butan-1-one |
|---|---|
| PubChem CID | 102166636 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 1,4-bis(3,5-dimethylpyrazol-1-yl)butan-1-one |
| SMILES | Cc1cc(C)n(CCCC(=O)n2nc(C)cc2C)n1 |
| InChI | InChI=1S/C14H20N4O/c1-10-8-12(3)17(15-10)7-5-6-14(19)18-13(4)9-11(2)16-18/h8-9H,5-7H2,1-4H3 |
| InChIKey | YRGOCCMDXLETOK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |