C11H19ClN2 — CID 62227990
1-(6-chlorohexyl)-3,5-dimethylpyrazole (PubChem CID 62227990) has the molecular formula C11H19ClN2 and a molecular weight of 214.74 g/mol. Its IUPAC name is 1-(6-chlorohexyl)-3,5-dimethylpyrazole.
| Compound Name | 1-(6-chlorohexyl)-3,5-dimethylpyrazole |
|---|---|
| PubChem CID | 62227990 |
| Molecular Formula | C11H19ClN2 |
| Molecular Weight | 214.74 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 1-(6-chlorohexyl)-3,5-dimethylpyrazole |
| SMILES | Cc1cc(C)n(CCCCCCCl)n1 |
| InChI | InChI=1S/C11H19ClN2/c1-10-9-11(2)14(13-10)8-6-4-3-5-7-12/h9H,3-8H2,1-2H3 |
| InChIKey | AKFWJZYPKNTAIX-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.74 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|