C23H22ClIN2O3 — CID 126377643
(E)-3-[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]-2-(pyrrolidine-1-carbonyl)prop-2-enenitrile (PubChem CID 126377643) has the molecular formula C23H22ClIN2O3 and a molecular weight of 536.80 g/mol. Its IUPAC name is (E)-3-[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]-2-(pyrrolidine-1-carbonyl)prop-2-enenitrile.
| Compound Name | (E)-3-[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]-2-(pyrrolidine-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126377643 |
| Molecular Formula | C23H22ClIN2O3 |
| Molecular Weight | 536.80 g/mol |
| Exact Mass | 536.04 |
| IUPAC Name | (E)-3-[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]-2-(pyrrolidine-1-carbonyl)prop-2-enenitrile |
| SMILES | CCOc1cc(/C=C(\C#N)C(=O)N2CCCC2)cc(I)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C23H22ClIN2O3/c1-2-29-21-13-16(11-18(14-26)23(28)27-9-5-6-10-27)12-20(25)22(21)30-15-17-7-3-4-8-19(17)24/h3-4,7-8,11-13H,2,5-6,9-10,15H2,1H3/b18-11+ |
| InChIKey | VLCOIGUXZWYBRX-WOJGMQOQSA-N |
| XLogP | 5.45 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.80 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|