C27H25IN2O4 — CID 126099651
(Z)-3-[3-ethoxy-5-iodo-4-(naphthalen-2-ylmethoxy)phenyl]-2-(morpholine-4-carbonyl)prop-2-enenitrile (PubChem CID 126099651) has the molecular formula C27H25IN2O4 and a molecular weight of 568.41 g/mol. Its IUPAC name is (Z)-3-[3-ethoxy-5-iodo-4-(naphthalen-2-ylmethoxy)phenyl]-2-(morpholine-4-carbonyl)prop-2-enenitrile.
| Compound Name | (Z)-3-[3-ethoxy-5-iodo-4-(naphthalen-2-ylmethoxy)phenyl]-2-(morpholine-4-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126099651 |
| Molecular Formula | C27H25IN2O4 |
| Molecular Weight | 568.41 g/mol |
| Exact Mass | 568.09 |
| IUPAC Name | (Z)-3-[3-ethoxy-5-iodo-4-(naphthalen-2-ylmethoxy)phenyl]-2-(morpholine-4-carbonyl)prop-2-enenitrile |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)N2CCOCC2)cc(I)c1OCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H25IN2O4/c1-2-33-25-16-20(14-23(17-29)27(31)30-9-11-32-12-10-30)15-24(28)26(25)34-18-19-7-8-21-5-3-4-6-22(21)13-19/h3-8,13-16H,2,9-12,18H2,1H3/b23-14- |
| InChIKey | YRLFIDXNCULPON-UCQKPKSFSA-N |
| XLogP | 5.19 |
| TPSA | 71.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.41 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|