C21H18I2N2O3 — CID 126098442
(Z)-3-(3,5-diiodo-4-phenylmethoxyphenyl)-2-(morpholine-4-carbonyl)prop-2-enenitrile (PubChem CID 126098442) has the molecular formula C21H18I2N2O3 and a molecular weight of 600.19 g/mol. Its IUPAC name is (Z)-3-(3,5-diiodo-4-phenylmethoxyphenyl)-2-(morpholine-4-carbonyl)prop-2-enenitrile.
| Compound Name | (Z)-3-(3,5-diiodo-4-phenylmethoxyphenyl)-2-(morpholine-4-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126098442 |
| Molecular Formula | C21H18I2N2O3 |
| Molecular Weight | 600.19 g/mol |
| Exact Mass | 599.94 |
| IUPAC Name | (Z)-3-(3,5-diiodo-4-phenylmethoxyphenyl)-2-(morpholine-4-carbonyl)prop-2-enenitrile |
| SMILES | N#C/C(=C/c1cc(I)c(OCc2ccccc2)c(I)c1)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C21H18I2N2O3/c22-18-11-16(10-17(13-24)21(26)25-6-8-27-9-7-25)12-19(23)20(18)28-14-15-4-2-1-3-5-15/h1-5,10-12H,6-9,14H2/b17-10- |
| InChIKey | SVMCHMBRTJVYAE-YVLHZVERSA-N |
| XLogP | 4.24 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.19 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|