C27H23ClIN3O2 — CID 124534231
(Z)-3-[4-[(4-chlorophenyl)methoxy]-3-iodophenyl]-2-(4-phenylpiperazine-1-carbonyl)prop-2-enenitrile (PubChem CID 124534231) has the molecular formula C27H23ClIN3O2 and a molecular weight of 583.86 g/mol. Its IUPAC name is (Z)-3-[4-[(4-chlorophenyl)methoxy]-3-iodophenyl]-2-(4-phenylpiperazine-1-carbonyl)prop-2-enenitrile.
| Compound Name | (Z)-3-[4-[(4-chlorophenyl)methoxy]-3-iodophenyl]-2-(4-phenylpiperazine-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 124534231 |
| Molecular Formula | C27H23ClIN3O2 |
| Molecular Weight | 583.86 g/mol |
| Exact Mass | 583.05 |
| IUPAC Name | (Z)-3-[4-[(4-chlorophenyl)methoxy]-3-iodophenyl]-2-(4-phenylpiperazine-1-carbonyl)prop-2-enenitrile |
| SMILES | N#C/C(=C/c1ccc(OCc2ccc(Cl)cc2)c(I)c1)C(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C27H23ClIN3O2/c28-23-9-6-20(7-10-23)19-34-26-11-8-21(17-25(26)29)16-22(18-30)27(33)32-14-12-31(13-15-32)24-4-2-1-3-5-24/h1-11,16-17H,12-15,19H2/b22-16- |
| InChIKey | PYGJAVBPYSJWNJ-JWGURIENSA-N |
| XLogP | 5.78 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.86 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|