C28H25BrClN3O3 — CID 124534238
(Z)-3-[4-[(4-bromophenyl)methoxy]-3-chloro-5-methoxyphenyl]-2-(4-phenylpiperazine-1-carbonyl)prop-2-enenitrile (PubChem CID 124534238) has the molecular formula C28H25BrClN3O3 and a molecular weight of 566.88 g/mol. Its IUPAC name is (Z)-3-[4-[(4-bromophenyl)methoxy]-3-chloro-5-methoxyphenyl]-2-(4-phenylpiperazine-1-carbonyl)prop-2-enenitrile.
| Compound Name | (Z)-3-[4-[(4-bromophenyl)methoxy]-3-chloro-5-methoxyphenyl]-2-(4-phenylpiperazine-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 124534238 |
| Molecular Formula | C28H25BrClN3O3 |
| Molecular Weight | 566.88 g/mol |
| Exact Mass | 565.08 |
| IUPAC Name | (Z)-3-[4-[(4-bromophenyl)methoxy]-3-chloro-5-methoxyphenyl]-2-(4-phenylpiperazine-1-carbonyl)prop-2-enenitrile |
| SMILES | COc1cc(/C=C(/C#N)C(=O)N2CCN(c3ccccc3)CC2)cc(Cl)c1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C28H25BrClN3O3/c1-35-26-17-21(16-25(30)27(26)36-19-20-7-9-23(29)10-8-20)15-22(18-31)28(34)33-13-11-32(12-14-33)24-5-3-2-4-6-24/h2-10,15-17H,11-14,19H2,1H3/b22-15- |
| InChIKey | LNSXBECTWSYPMX-JCMHNJIXSA-N |
| XLogP | 5.95 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.88 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|