C31H29Cl2N3O3 — CID 124534350
(Z)-3-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]-2-(4-phenylpiperazine-1-carbonyl)prop-2-enenitrile (PubChem CID 124534350) has the molecular formula C31H29Cl2N3O3 and a molecular weight of 562.50 g/mol. Its IUPAC name is (Z)-3-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]-2-(4-phenylpiperazine-1-carbonyl)prop-2-enenitrile.
| Compound Name | (Z)-3-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]-2-(4-phenylpiperazine-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 124534350 |
| Molecular Formula | C31H29Cl2N3O3 |
| Molecular Weight | 562.50 g/mol |
| Exact Mass | 561.16 |
| IUPAC Name | (Z)-3-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]-2-(4-phenylpiperazine-1-carbonyl)prop-2-enenitrile |
| SMILES | C=CCc1cc(/C=C(/C#N)C(=O)N2CCN(c3ccccc3)CC2)cc(OC)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C31H29Cl2N3O3/c1-3-7-23-16-22(18-29(38-2)30(23)39-21-24-10-11-26(32)19-28(24)33)17-25(20-34)31(37)36-14-12-35(13-15-36)27-8-5-4-6-9-27/h3-6,8-11,16-19H,1,7,12-15,21H2,2H3/b25-17- |
| InChIKey | GVYFFXOEKQZKIJ-UQQQWYQISA-N |
| XLogP | 6.57 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.50 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|