C26H26Cl2N2O3 — CID 126198957
(Z)-2-cyano-N-cyclopentyl-3-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]prop-2-enamide (PubChem CID 126198957) has the molecular formula C26H26Cl2N2O3 and a molecular weight of 485.41 g/mol. Its IUPAC name is (Z)-2-cyano-N-cyclopentyl-3-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-cyclopentyl-3-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126198957 |
| Molecular Formula | C26H26Cl2N2O3 |
| Molecular Weight | 485.41 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | (Z)-2-cyano-N-cyclopentyl-3-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]prop-2-enamide |
| SMILES | C=CCc1cc(/C=C(/C#N)C(=O)NC2CCCC2)cc(OC)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H26Cl2N2O3/c1-3-6-18-11-17(12-20(15-29)26(31)30-22-7-4-5-8-22)13-24(32-2)25(18)33-16-19-9-10-21(27)14-23(19)28/h3,9-14,22H,1,4-8,16H2,2H3,(H,30,31)/b20-12- |
| InChIKey | ZUVIMWVMCVYNJF-NDENLUEZSA-N |
| XLogP | 6.28 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.41 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|