C21H18Cl2N2O2 — CID 126376555
(E)-3-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-2-(pyrrolidine-1-carbonyl)prop-2-enenitrile (PubChem CID 126376555) has the molecular formula C21H18Cl2N2O2 and a molecular weight of 401.29 g/mol. Its IUPAC name is (E)-3-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-2-(pyrrolidine-1-carbonyl)prop-2-enenitrile.
| Compound Name | (E)-3-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-2-(pyrrolidine-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126376555 |
| Molecular Formula | C21H18Cl2N2O2 |
| Molecular Weight | 401.29 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | (E)-3-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-2-(pyrrolidine-1-carbonyl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(OCc2ccc(Cl)cc2Cl)cc1)C(=O)N1CCCC1 |
| InChI | InChI=1S/C21H18Cl2N2O2/c22-18-6-5-16(20(23)12-18)14-27-19-7-3-15(4-8-19)11-17(13-24)21(26)25-9-1-2-10-25/h3-8,11-12H,1-2,9-10,14H2/b17-11+ |
| InChIKey | MNKUCULSLKIETO-GZTJUZNOSA-N |
| XLogP | 5.10 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.29 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|