C16H17N3O3 — CID 126373493
2-[4-[(E)-2-cyano-3-oxo-3-pyrrolidin-1-ylprop-1-enyl]phenoxy]acetamide (PubChem CID 126373493) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is 2-[4-[(E)-2-cyano-3-oxo-3-pyrrolidin-1-ylprop-1-enyl]phenoxy]acetamide.
| Compound Name | 2-[4-[(E)-2-cyano-3-oxo-3-pyrrolidin-1-ylprop-1-enyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126373493 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 2-[4-[(E)-2-cyano-3-oxo-3-pyrrolidin-1-ylprop-1-enyl]phenoxy]acetamide |
| SMILES | N#C/C(=C\c1ccc(OCC(N)=O)cc1)C(=O)N1CCCC1 |
| InChI | InChI=1S/C16H17N3O3/c17-10-13(16(21)19-7-1-2-8-19)9-12-3-5-14(6-4-12)22-11-15(18)20/h3-6,9H,1-2,7-8,11H2,(H2,18,20)/b13-9+ |
| InChIKey | PNZCGMLVDQEQKF-UKTHLTGXSA-N |
| XLogP | 1.08 |
| TPSA | 96.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|