C17H21FN2O2 — CID 21179251
ethanol;(E)-3-(4-fluorophenyl)-2-(piperidine-1-carbonyl)prop-2-enenitrile (PubChem CID 21179251) has the molecular formula C17H21FN2O2 and a molecular weight of 304.37 g/mol. Its IUPAC name is ethanol;(E)-3-(4-fluorophenyl)-2-(piperidine-1-carbonyl)prop-2-enenitrile.
| Compound Name | ethanol;(E)-3-(4-fluorophenyl)-2-(piperidine-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 21179251 |
| Molecular Formula | C17H21FN2O2 |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | ethanol;(E)-3-(4-fluorophenyl)-2-(piperidine-1-carbonyl)prop-2-enenitrile |
| SMILES | CCO.N#C/C(=C\c1ccc(F)cc1)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C15H15FN2O.C2H6O/c16-14-6-4-12(5-7-14)10-13(11-17)15(19)18-8-2-1-3-9-18;1-2-3/h4-7,10H,1-3,8-9H2;3H,2H2,1H3/b13-10+; |
| InChIKey | CLRYVENGQWQXCG-RSGUCCNWSA-N |
| XLogP | 2.74 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|