C17H19N3O3 — CID 6056242
2-[4-[(E)-2-cyano-3-oxo-3-piperidin-1-ylprop-1-enyl]phenoxy]acetamide (PubChem CID 6056242) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is 2-[4-[(E)-2-cyano-3-oxo-3-piperidin-1-ylprop-1-enyl]phenoxy]acetamide.
| Compound Name | 2-[4-[(E)-2-cyano-3-oxo-3-piperidin-1-ylprop-1-enyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 6056242 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 2-[4-[(E)-2-cyano-3-oxo-3-piperidin-1-ylprop-1-enyl]phenoxy]acetamide |
| SMILES | N#C/C(=C\c1ccc(OCC(N)=O)cc1)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C17H19N3O3/c18-11-14(17(22)20-8-2-1-3-9-20)10-13-4-6-15(7-5-13)23-12-16(19)21/h4-7,10H,1-3,8-9,12H2,(H2,19,21)/b14-10+ |
| InChIKey | YZQFZEGSGPENBS-GXDHUFHOSA-N |
| XLogP | 1.47 |
| TPSA | 96.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|