C15H16N2O — CID 4666203
3-(4-methylphenyl)-2-(pyrrolidine-1-carbonyl)prop-2-enenitrile (PubChem CID 4666203) has the molecular formula C15H16N2O and a molecular weight of 240.31 g/mol. Its IUPAC name is 3-(4-methylphenyl)-2-(pyrrolidine-1-carbonyl)prop-2-enenitrile.
| Compound Name | 3-(4-methylphenyl)-2-(pyrrolidine-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 4666203 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 3-(4-methylphenyl)-2-(pyrrolidine-1-carbonyl)prop-2-enenitrile |
| SMILES | Cc1ccc(C=C(C#N)C(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C15H16N2O/c1-12-4-6-13(7-5-12)10-14(11-16)15(18)17-8-2-3-9-17/h4-7,10H,2-3,8-9H2,1H3 |
| InChIKey | AHUBFLBBLXYBBU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|