C25H20Cl2N2O2 — CID 44808266
(E)-2-cyano-3-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-N-(1-phenylethyl)prop-2-enamide (PubChem CID 44808266) has the molecular formula C25H20Cl2N2O2 and a molecular weight of 451.35 g/mol. Its IUPAC name is (E)-2-cyano-3-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-N-(1-phenylethyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-N-(1-phenylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 44808266 |
| Molecular Formula | C25H20Cl2N2O2 |
| Molecular Weight | 451.35 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | (E)-2-cyano-3-[4-[(2,4-dichlorophenyl)methoxy]phenyl]-N-(1-phenylethyl)prop-2-enamide |
| SMILES | CC(NC(=O)/C(C#N)=C/c1ccc(OCc2ccc(Cl)cc2Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H20Cl2N2O2/c1-17(19-5-3-2-4-6-19)29-25(30)21(15-28)13-18-7-11-23(12-8-18)31-16-20-9-10-22(26)14-24(20)27/h2-14,17H,16H2,1H3,(H,29,30)/b21-13+ |
| InChIKey | MYVYWVXJXYVNJY-FYJGNVAPSA-N |
| XLogP | 6.36 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.35 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|