C19H15N3O — CID 18775922
(E)-2-cyano-3-(4-cyanophenyl)-N-(1-phenylethyl)prop-2-enamide (PubChem CID 18775922) has the molecular formula C19H15N3O and a molecular weight of 301.35 g/mol. Its IUPAC name is (E)-2-cyano-3-(4-cyanophenyl)-N-(1-phenylethyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(4-cyanophenyl)-N-(1-phenylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 18775922 |
| Molecular Formula | C19H15N3O |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | (E)-2-cyano-3-(4-cyanophenyl)-N-(1-phenylethyl)prop-2-enamide |
| SMILES | CC(NC(=O)/C(C#N)=C/c1ccc(C#N)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H15N3O/c1-14(17-5-3-2-4-6-17)22-19(23)18(13-21)11-15-7-9-16(12-20)10-8-15/h2-11,14H,1H3,(H,22,23)/b18-11+ |
| InChIKey | CSEWJWBTPGAABQ-WOJGMQOQSA-N |
| XLogP | 3.34 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|