C20H18N2O3 — CID 2438064
methyl 4-[(E)-2-cyano-3-oxo-3-[[(1S)-1-phenylethyl]amino]prop-1-enyl]benzoate (PubChem CID 2438064) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is methyl 4-[(E)-2-cyano-3-oxo-3-[[(1S)-1-phenylethyl]amino]prop-1-enyl]benzoate.
| Compound Name | methyl 4-[(E)-2-cyano-3-oxo-3-[[(1S)-1-phenylethyl]amino]prop-1-enyl]benzoate |
|---|---|
| PubChem CID | 2438064 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | methyl 4-[(E)-2-cyano-3-oxo-3-[[(1S)-1-phenylethyl]amino]prop-1-enyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C(\C#N)C(=O)N[C@@H](C)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H18N2O3/c1-14(16-6-4-3-5-7-16)22-19(23)18(13-21)12-15-8-10-17(11-9-15)20(24)25-2/h3-12,14H,1-2H3,(H,22,23)/b18-12+/t14-/m0/s1 |
| InChIKey | RUXHXCUDZVVGRO-QCUKBLKESA-N |
| XLogP | 3.26 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|