C26H24N2O2 — CID 124646685
(Z)-2-cyano-3-[4-[(4-methylphenyl)methoxy]phenyl]-N-[(1R)-1-phenylethyl]prop-2-enamide (PubChem CID 124646685) has the molecular formula C26H24N2O2 and a molecular weight of 396.49 g/mol. Its IUPAC name is (Z)-2-cyano-3-[4-[(4-methylphenyl)methoxy]phenyl]-N-[(1R)-1-phenylethyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[4-[(4-methylphenyl)methoxy]phenyl]-N-[(1R)-1-phenylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 124646685 |
| Molecular Formula | C26H24N2O2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | (Z)-2-cyano-3-[4-[(4-methylphenyl)methoxy]phenyl]-N-[(1R)-1-phenylethyl]prop-2-enamide |
| SMILES | Cc1ccc(COc2ccc(/C=C(/C#N)C(=O)N[C@H](C)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C26H24N2O2/c1-19-8-10-22(11-9-19)18-30-25-14-12-21(13-15-25)16-24(17-27)26(29)28-20(2)23-6-4-3-5-7-23/h3-16,20H,18H2,1-2H3,(H,28,29)/b24-16-/t20-/m1/s1 |
| InChIKey | RNUOUMFQQFNPRK-VMTJQQBPSA-N |
| XLogP | 5.36 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|