About propan-2-yl (E)-2-cyano-3-[4-[(4-methylphenyl)methoxy]phenyl]prop-2-enoate
propan-2-yl (E)-2-cyano-3-[4-[(4-methylphenyl)methoxy]phenyl]prop-2-enoate (PubChem CID 18230863) has the molecular formula C21H21NO3
and a molecular weight of 335.40 g/mol. Its IUPAC name is propan-2-yl (E)-2-cyano-3-[4-[(4-methylphenyl)methoxy]phenyl]prop-2-enoate.
Molecular Properties
| Compound Name | propan-2-yl (E)-2-cyano-3-[4-[(4-methylphenyl)methoxy]phenyl]prop-2-enoate |
| PubChem CID | 18230863 |
| Molecular Formula | C21H21NO3 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | propan-2-yl (E)-2-cyano-3-[4-[(4-methylphenyl)methoxy]phenyl]prop-2-enoate |
| SMILES | Cc1ccc(COc2ccc(/C=C(\C#N)C(=O)OC(C)C)cc2)cc1 |
| InChI | InChI=1S/C21H21NO3/c1-15(2)25-21(23)19(13-22)12-17-8-10-20(11-9-17)24-14-18-6-4-16(3)5-7-18/h4-12,15H,14H2,1-3H3/b19-12+ |
| InChIKey | VSCQZAGLVWDHGY-XDHOZWIPSA-N |
| XLogP | 4.43 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl (E)-2-cyano-3-[4-[(4-methylphenyl)methoxy]phenyl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl (E)-2-cyano-3-[4-[(4-methylphenyl)methoxy]phenyl]prop-2-enoate?
The IUPAC name of propan-2-yl (E)-2-cyano-3-[4-[(4-methylphenyl)methoxy]phenyl]prop-2-enoate (CID 18230863) is propan-2-yl (E)-2-cyano-3-[4-[(4-methylphenyl)methoxy]phenyl]prop-2-enoate.
What is the SMILES notation for propan-2-yl (E)-2-cyano-3-[4-[(4-methylphenyl)methoxy]phenyl]prop-2-enoate?
The canonical SMILES for propan-2-yl (E)-2-cyano-3-[4-[(4-methylphenyl)methoxy]phenyl]prop-2-enoate is Cc1ccc(COc2ccc(/C=C(\C#N)C(=O)OC(C)C)cc2)cc1.
What is the InChIKey of propan-2-yl (E)-2-cyano-3-[4-[(4-methylphenyl)methoxy]phenyl]prop-2-enoate?
The InChIKey is VSCQZAGLVWDHGY-XDHOZWIPSA-N. The full InChI is InChI=1S/C21H21NO3/c1-15(2)25-21(23)19(13-22)12-17-8-10-20(11-9-17)24-14-18-6-4-16(3)5-7-18/h4-12,15H,14H2,1-3H3/b19-12+.
What are the key properties of propan-2-yl (E)-2-cyano-3-[4-[(4-methylphenyl)methoxy]phenyl]prop-2-enoate?
propan-2-yl (E)-2-cyano-3-[4-[(4-methylphenyl)methoxy]phenyl]prop-2-enoate has a molecular weight of 335.40 g/mol, XLogP of 4.43, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl (E)-2-cyano-3-[4-[(4-methylphenyl)methoxy]phenyl]prop-2-enoate is sourced from PubChem (CID 18230863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).