C18H14NO3- — CID 7801676
(E)-2-cyano-3-[4-[(4-methylphenyl)methoxy]phenyl]prop-2-enoate (PubChem CID 7801676) has the molecular formula C18H14NO3- and a molecular weight of 292.31 g/mol. Its IUPAC name is (E)-2-cyano-3-[4-[(4-methylphenyl)methoxy]phenyl]prop-2-enoate.
| Compound Name | (E)-2-cyano-3-[4-[(4-methylphenyl)methoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 7801676 |
| Molecular Formula | C18H14NO3- |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | (E)-2-cyano-3-[4-[(4-methylphenyl)methoxy]phenyl]prop-2-enoate |
| SMILES | Cc1ccc(COc2ccc(/C=C(\C#N)C(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C18H15NO3/c1-13-2-4-15(5-3-13)12-22-17-8-6-14(7-9-17)10-16(11-19)18(20)21/h2-10H,12H2,1H3,(H,20,21)/p-1/b16-10+ |
| InChIKey | CTTFFZFVIVRXNB-MHWRWJLKSA-M |
| XLogP | 2.23 |
| TPSA | 73.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|