C19H16NO3- — CID 23121230
(E)-2-cyano-3-[4-(3-phenylpropoxy)phenyl]prop-2-enoate (PubChem CID 23121230) has the molecular formula C19H16NO3- and a molecular weight of 306.34 g/mol. Its IUPAC name is (E)-2-cyano-3-[4-(3-phenylpropoxy)phenyl]prop-2-enoate.
| Compound Name | (E)-2-cyano-3-[4-(3-phenylpropoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 23121230 |
| Molecular Formula | C19H16NO3- |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | (E)-2-cyano-3-[4-(3-phenylpropoxy)phenyl]prop-2-enoate |
| SMILES | N#C/C(=C\c1ccc(OCCCc2ccccc2)cc1)C(=O)[O-] |
| InChI | InChI=1S/C19H17NO3/c20-14-17(19(21)22)13-16-8-10-18(11-9-16)23-12-4-7-15-5-2-1-3-6-15/h1-3,5-6,8-11,13H,4,7,12H2,(H,21,22)/p-1/b17-13+ |
| InChIKey | YXUBOSISTWBJFE-GHRIWEEISA-M |
| XLogP | 2.36 |
| TPSA | 73.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|