C24H17N2O4- — CID 7028674
2-[[(E)-2-cyano-3-(4-phenylmethoxyphenyl)prop-2-enoyl]amino]benzoate (PubChem CID 7028674) has the molecular formula C24H17N2O4- and a molecular weight of 397.41 g/mol. Its IUPAC name is 2-[[(E)-2-cyano-3-(4-phenylmethoxyphenyl)prop-2-enoyl]amino]benzoate.
| Compound Name | 2-[[(E)-2-cyano-3-(4-phenylmethoxyphenyl)prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 7028674 |
| Molecular Formula | C24H17N2O4- |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 2-[[(E)-2-cyano-3-(4-phenylmethoxyphenyl)prop-2-enoyl]amino]benzoate |
| SMILES | N#C/C(=C\c1ccc(OCc2ccccc2)cc1)C(=O)Nc1ccccc1C(=O)[O-] |
| InChI | InChI=1S/C24H18N2O4/c25-15-19(23(27)26-22-9-5-4-8-21(22)24(28)29)14-17-10-12-20(13-11-17)30-16-18-6-2-1-3-7-18/h1-14H,16H2,(H,26,27)(H,28,29)/p-1/b19-14+ |
| InChIKey | ITGXZCCLSIKOAD-XMHGGMMESA-M |
| XLogP | 3.17 |
| TPSA | 102.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|