C25H19N2O4- — CID 7476837
4-[[4-[(Z)-3-(benzylamino)-2-cyano-3-oxoprop-1-enyl]phenoxy]methyl]benzoate (PubChem CID 7476837) has the molecular formula C25H19N2O4- and a molecular weight of 411.44 g/mol. Its IUPAC name is 4-[[4-[(Z)-3-(benzylamino)-2-cyano-3-oxoprop-1-enyl]phenoxy]methyl]benzoate.
| Compound Name | 4-[[4-[(Z)-3-(benzylamino)-2-cyano-3-oxoprop-1-enyl]phenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 7476837 |
| Molecular Formula | C25H19N2O4- |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 4-[[4-[(Z)-3-(benzylamino)-2-cyano-3-oxoprop-1-enyl]phenoxy]methyl]benzoate |
| SMILES | N#C/C(=C/c1ccc(OCc2ccc(C(=O)[O-])cc2)cc1)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C25H20N2O4/c26-15-22(24(28)27-16-19-4-2-1-3-5-19)14-18-8-12-23(13-9-18)31-17-20-6-10-21(11-7-20)25(29)30/h1-14H,16-17H2,(H,27,28)(H,29,30)/p-1/b22-14- |
| InChIKey | CPILICKJALBYDF-HMAPJEAMSA-M |
| XLogP | 2.85 |
| TPSA | 102.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|