About dipotassium;1-bromo-4-(4-phenylbutoxy)benzene;carbonate
dipotassium;1-bromo-4-(4-phenylbutoxy)benzene;carbonate (PubChem CID 157345780) has the molecular formula C17H17BrK2O4
and a molecular weight of 443.42 g/mol. Its IUPAC name is dipotassium;1-bromo-4-(4-phenylbutoxy)benzene;carbonate.
Molecular Properties
| Compound Name | dipotassium;1-bromo-4-(4-phenylbutoxy)benzene;carbonate |
| PubChem CID | 157345780 |
| Molecular Formula | C17H17BrK2O4 |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 441.96 |
| IUPAC Name | dipotassium;1-bromo-4-(4-phenylbutoxy)benzene;carbonate |
| SMILES | Brc1ccc(OCCCCc2ccccc2)cc1.O=C([O-])[O-].[K+].[K+] |
| InChI | InChI=1S/C16H17BrO.CH2O3.2K/c17-15-9-11-16(12-10-15)18-13-5-4-8-14-6-2-1-3-7-14;2-1(3)4;;/h1-3,6-7,9-12H,4-5,8,13H2;(H2,2,3,4);;/q;;2*+1/p-2 |
| InChIKey | BGYICXKLUPTLJD-UHFFFAOYSA-L |
| XLogP | -3.59 |
| TPSA | 72.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | -3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dipotassium;1-bromo-4-(4-phenylbutoxy)benzene;carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;1-bromo-4-(4-phenylbutoxy)benzene;carbonate?
The IUPAC name of dipotassium;1-bromo-4-(4-phenylbutoxy)benzene;carbonate (CID 157345780) is dipotassium;1-bromo-4-(4-phenylbutoxy)benzene;carbonate.
What is the SMILES notation for dipotassium;1-bromo-4-(4-phenylbutoxy)benzene;carbonate?
The canonical SMILES for dipotassium;1-bromo-4-(4-phenylbutoxy)benzene;carbonate is Brc1ccc(OCCCCc2ccccc2)cc1.O=C([O-])[O-].[K+].[K+].
What is the InChIKey of dipotassium;1-bromo-4-(4-phenylbutoxy)benzene;carbonate?
The InChIKey is BGYICXKLUPTLJD-UHFFFAOYSA-L. The full InChI is InChI=1S/C16H17BrO.CH2O3.2K/c17-15-9-11-16(12-10-15)18-13-5-4-8-14-6-2-1-3-7-14;2-1(3)4;;/h1-3,6-7,9-12H,4-5,8,13H2;(H2,2,3,4);;/q;;2*+1/p-2.
What are the key properties of dipotassium;1-bromo-4-(4-phenylbutoxy)benzene;carbonate?
dipotassium;1-bromo-4-(4-phenylbutoxy)benzene;carbonate has a molecular weight of 443.42 g/mol, XLogP of -3.59, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;1-bromo-4-(4-phenylbutoxy)benzene;carbonate is sourced from PubChem (CID 157345780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).