C27H23BrCl2N2O3 — CID 171138880
3-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]-2-cyano-N-(1-phenylethyl)prop-2-enamide (PubChem CID 171138880) has the molecular formula C27H23BrCl2N2O3 and a molecular weight of 574.30 g/mol. Its IUPAC name is 3-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]-2-cyano-N-(1-phenylethyl)prop-2-enamide.
| Compound Name | 3-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]-2-cyano-N-(1-phenylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 171138880 |
| Molecular Formula | C27H23BrCl2N2O3 |
| Molecular Weight | 574.30 g/mol |
| Exact Mass | 572.03 |
| IUPAC Name | 3-[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]-2-cyano-N-(1-phenylethyl)prop-2-enamide |
| SMILES | CCOc1cc(C=C(C#N)C(=O)NC(C)c2ccccc2)cc(Br)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C27H23BrCl2N2O3/c1-3-34-25-13-18(11-21(15-31)27(33)32-17(2)19-7-5-4-6-8-19)12-23(28)26(25)35-16-20-9-10-22(29)14-24(20)30/h4-14,17H,3,16H2,1-2H3,(H,32,33) |
| InChIKey | SMQJOWQADAZNNT-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.30 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|