C24H27BrN2O3 — CID 126243195
(Z)-3-[3-bromo-4-[(2S)-butan-2-yl]oxy-5-ethoxyphenyl]-2-cyano-N-[(1S)-1-phenylethyl]prop-2-enamide (PubChem CID 126243195) has the molecular formula C24H27BrN2O3 and a molecular weight of 471.40 g/mol. Its IUPAC name is (Z)-3-[3-bromo-4-[(2S)-butan-2-yl]oxy-5-ethoxyphenyl]-2-cyano-N-[(1S)-1-phenylethyl]prop-2-enamide.
| Compound Name | (Z)-3-[3-bromo-4-[(2S)-butan-2-yl]oxy-5-ethoxyphenyl]-2-cyano-N-[(1S)-1-phenylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 126243195 |
| Molecular Formula | C24H27BrN2O3 |
| Molecular Weight | 471.40 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | (Z)-3-[3-bromo-4-[(2S)-butan-2-yl]oxy-5-ethoxyphenyl]-2-cyano-N-[(1S)-1-phenylethyl]prop-2-enamide |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)N[C@@H](C)c2ccccc2)cc(Br)c1O[C@@H](C)CC |
| InChI | InChI=1S/C24H27BrN2O3/c1-5-16(3)30-23-21(25)13-18(14-22(23)29-6-2)12-20(15-26)24(28)27-17(4)19-10-8-7-9-11-19/h7-14,16-17H,5-6H2,1-4H3,(H,27,28)/b20-12-/t16-,17-/m0/s1 |
| InChIKey | ULCPBMSSTHRXEU-SYHQVDNTSA-N |
| XLogP | 5.81 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.40 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|