C23H21IN2O3 — CID 126261474
(Z)-2-cyano-3-(3-ethoxy-5-iodo-4-prop-2-ynoxyphenyl)-N-[(1S)-1-phenylethyl]prop-2-enamide (PubChem CID 126261474) has the molecular formula C23H21IN2O3 and a molecular weight of 500.34 g/mol. Its IUPAC name is (Z)-2-cyano-3-(3-ethoxy-5-iodo-4-prop-2-ynoxyphenyl)-N-[(1S)-1-phenylethyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(3-ethoxy-5-iodo-4-prop-2-ynoxyphenyl)-N-[(1S)-1-phenylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 126261474 |
| Molecular Formula | C23H21IN2O3 |
| Molecular Weight | 500.34 g/mol |
| Exact Mass | 500.06 |
| IUPAC Name | (Z)-2-cyano-3-(3-ethoxy-5-iodo-4-prop-2-ynoxyphenyl)-N-[(1S)-1-phenylethyl]prop-2-enamide |
| SMILES | C#CCOc1c(I)cc(/C=C(/C#N)C(=O)N[C@@H](C)c2ccccc2)cc1OCC |
| InChI | InChI=1S/C23H21IN2O3/c1-4-11-29-22-20(24)13-17(14-21(22)28-5-2)12-19(15-25)23(27)26-16(3)18-9-7-6-8-10-18/h1,6-10,12-14,16H,5,11H2,2-3H3,(H,26,27)/b19-12-/t16-/m0/s1 |
| InChIKey | YRDZOPDUMBFCEA-JJBLJPBOSA-N |
| XLogP | 4.49 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.34 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|