C23H21BrN2O3 — CID 126244990
(Z)-3-(2-bromo-5-ethoxy-4-prop-2-ynoxyphenyl)-2-cyano-N-[(1R)-1-phenylethyl]prop-2-enamide (PubChem CID 126244990) has the molecular formula C23H21BrN2O3 and a molecular weight of 453.34 g/mol. Its IUPAC name is (Z)-3-(2-bromo-5-ethoxy-4-prop-2-ynoxyphenyl)-2-cyano-N-[(1R)-1-phenylethyl]prop-2-enamide.
| Compound Name | (Z)-3-(2-bromo-5-ethoxy-4-prop-2-ynoxyphenyl)-2-cyano-N-[(1R)-1-phenylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 126244990 |
| Molecular Formula | C23H21BrN2O3 |
| Molecular Weight | 453.34 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | (Z)-3-(2-bromo-5-ethoxy-4-prop-2-ynoxyphenyl)-2-cyano-N-[(1R)-1-phenylethyl]prop-2-enamide |
| SMILES | C#CCOc1cc(Br)c(/C=C(/C#N)C(=O)N[C@H](C)c2ccccc2)cc1OCC |
| InChI | InChI=1S/C23H21BrN2O3/c1-4-11-29-22-14-20(24)18(13-21(22)28-5-2)12-19(15-25)23(27)26-16(3)17-9-7-6-8-10-17/h1,6-10,12-14,16H,5,11H2,2-3H3,(H,26,27)/b19-12-/t16-/m1/s1 |
| InChIKey | MACFDKZDAWMESM-BKAYVGFPSA-N |
| XLogP | 4.64 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.34 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|