C22H21BrN2O5 — CID 126240983
methyl 2-[5-bromo-4-[(Z)-2-cyano-3-oxo-3-[[(1S)-1-phenylethyl]amino]prop-1-enyl]-2-methoxyphenoxy]acetate (PubChem CID 126240983) has the molecular formula C22H21BrN2O5 and a molecular weight of 473.32 g/mol. Its IUPAC name is methyl 2-[5-bromo-4-[(Z)-2-cyano-3-oxo-3-[[(1S)-1-phenylethyl]amino]prop-1-enyl]-2-methoxyphenoxy]acetate.
| Compound Name | methyl 2-[5-bromo-4-[(Z)-2-cyano-3-oxo-3-[[(1S)-1-phenylethyl]amino]prop-1-enyl]-2-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 126240983 |
| Molecular Formula | C22H21BrN2O5 |
| Molecular Weight | 473.32 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | methyl 2-[5-bromo-4-[(Z)-2-cyano-3-oxo-3-[[(1S)-1-phenylethyl]amino]prop-1-enyl]-2-methoxyphenoxy]acetate |
| SMILES | COC(=O)COc1cc(Br)c(/C=C(/C#N)C(=O)N[C@@H](C)c2ccccc2)cc1OC |
| InChI | InChI=1S/C22H21BrN2O5/c1-14(15-7-5-4-6-8-15)25-22(27)17(12-24)9-16-10-19(28-2)20(11-18(16)23)30-13-21(26)29-3/h4-11,14H,13H2,1-3H3,(H,25,27)/b17-9-/t14-/m0/s1 |
| InChIKey | MMJLVSZPGMMKKX-DUPVFGOHSA-N |
| XLogP | 3.79 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.32 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|