C21H21ClN2O3 — CID 126226860
(Z)-3-(2-chloro-5-ethoxy-4-methoxyphenyl)-2-cyano-N-[(1S)-1-phenylethyl]prop-2-enamide (PubChem CID 126226860) has the molecular formula C21H21ClN2O3 and a molecular weight of 384.86 g/mol. Its IUPAC name is (Z)-3-(2-chloro-5-ethoxy-4-methoxyphenyl)-2-cyano-N-[(1S)-1-phenylethyl]prop-2-enamide.
| Compound Name | (Z)-3-(2-chloro-5-ethoxy-4-methoxyphenyl)-2-cyano-N-[(1S)-1-phenylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 126226860 |
| Molecular Formula | C21H21ClN2O3 |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | (Z)-3-(2-chloro-5-ethoxy-4-methoxyphenyl)-2-cyano-N-[(1S)-1-phenylethyl]prop-2-enamide |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)N[C@@H](C)c2ccccc2)c(Cl)cc1OC |
| InChI | InChI=1S/C21H21ClN2O3/c1-4-27-20-11-16(18(22)12-19(20)26-3)10-17(13-23)21(25)24-14(2)15-8-6-5-7-9-15/h5-12,14H,4H2,1-3H3,(H,24,25)/b17-10-/t14-/m0/s1 |
| InChIKey | CZBVLGPAJQVSLR-XGHPXPSOSA-N |
| XLogP | 4.53 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|