C24H25BrN2O5 — CID 126226888
ethyl 2-[5-bromo-4-[(Z)-2-cyano-3-oxo-3-[[(1S)-1-phenylethyl]amino]prop-1-enyl]-2-ethoxyphenoxy]acetate (PubChem CID 126226888) has the molecular formula C24H25BrN2O5 and a molecular weight of 501.38 g/mol. Its IUPAC name is ethyl 2-[5-bromo-4-[(Z)-2-cyano-3-oxo-3-[[(1S)-1-phenylethyl]amino]prop-1-enyl]-2-ethoxyphenoxy]acetate.
| Compound Name | ethyl 2-[5-bromo-4-[(Z)-2-cyano-3-oxo-3-[[(1S)-1-phenylethyl]amino]prop-1-enyl]-2-ethoxyphenoxy]acetate |
|---|---|
| PubChem CID | 126226888 |
| Molecular Formula | C24H25BrN2O5 |
| Molecular Weight | 501.38 g/mol |
| Exact Mass | 500.09 |
| IUPAC Name | ethyl 2-[5-bromo-4-[(Z)-2-cyano-3-oxo-3-[[(1S)-1-phenylethyl]amino]prop-1-enyl]-2-ethoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1cc(Br)c(/C=C(/C#N)C(=O)N[C@@H](C)c2ccccc2)cc1OCC |
| InChI | InChI=1S/C24H25BrN2O5/c1-4-30-21-12-18(20(25)13-22(21)32-15-23(28)31-5-2)11-19(14-26)24(29)27-16(3)17-9-7-6-8-10-17/h6-13,16H,4-5,15H2,1-3H3,(H,27,29)/b19-11-/t16-/m0/s1 |
| InChIKey | DJKOHUURCXGTEC-YLRSXTQRSA-N |
| XLogP | 4.57 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.38 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|