C30H25IN2O3 — CID 126247309
(Z)-2-cyano-3-[3-iodo-5-methoxy-4-(naphthalen-2-ylmethoxy)phenyl]-N-[(1R)-1-phenylethyl]prop-2-enamide (PubChem CID 126247309) has the molecular formula C30H25IN2O3 and a molecular weight of 588.45 g/mol. Its IUPAC name is (Z)-2-cyano-3-[3-iodo-5-methoxy-4-(naphthalen-2-ylmethoxy)phenyl]-N-[(1R)-1-phenylethyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[3-iodo-5-methoxy-4-(naphthalen-2-ylmethoxy)phenyl]-N-[(1R)-1-phenylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 126247309 |
| Molecular Formula | C30H25IN2O3 |
| Molecular Weight | 588.45 g/mol |
| Exact Mass | 588.09 |
| IUPAC Name | (Z)-2-cyano-3-[3-iodo-5-methoxy-4-(naphthalen-2-ylmethoxy)phenyl]-N-[(1R)-1-phenylethyl]prop-2-enamide |
| SMILES | COc1cc(/C=C(/C#N)C(=O)N[C@H](C)c2ccccc2)cc(I)c1OCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C30H25IN2O3/c1-20(23-8-4-3-5-9-23)33-30(34)26(18-32)15-22-16-27(31)29(28(17-22)35-2)36-19-21-12-13-24-10-6-7-11-25(24)14-21/h3-17,20H,19H2,1-2H3,(H,33,34)/b26-15-/t20-/m1/s1 |
| InChIKey | RKNJATYIJOHFIA-RWTUPJDWSA-N |
| XLogP | 6.82 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.45 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|