C27H25BrN2O3 — CID 126226695
(Z)-3-[3-bromo-5-methoxy-4-[(3-methylphenyl)methoxy]phenyl]-2-cyano-N-[(1R)-1-phenylethyl]prop-2-enamide (PubChem CID 126226695) has the molecular formula C27H25BrN2O3 and a molecular weight of 505.41 g/mol. Its IUPAC name is (Z)-3-[3-bromo-5-methoxy-4-[(3-methylphenyl)methoxy]phenyl]-2-cyano-N-[(1R)-1-phenylethyl]prop-2-enamide.
| Compound Name | (Z)-3-[3-bromo-5-methoxy-4-[(3-methylphenyl)methoxy]phenyl]-2-cyano-N-[(1R)-1-phenylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 126226695 |
| Molecular Formula | C27H25BrN2O3 |
| Molecular Weight | 505.41 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | (Z)-3-[3-bromo-5-methoxy-4-[(3-methylphenyl)methoxy]phenyl]-2-cyano-N-[(1R)-1-phenylethyl]prop-2-enamide |
| SMILES | COc1cc(/C=C(/C#N)C(=O)N[C@H](C)c2ccccc2)cc(Br)c1OCc1cccc(C)c1 |
| InChI | InChI=1S/C27H25BrN2O3/c1-18-8-7-9-20(12-18)17-33-26-24(28)14-21(15-25(26)32-3)13-23(16-29)27(31)30-19(2)22-10-5-4-6-11-22/h4-15,19H,17H2,1-3H3,(H,30,31)/b23-13-/t19-/m1/s1 |
| InChIKey | ARZJTPJZFNJXMY-AYBNGVQBSA-N |
| XLogP | 6.13 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.41 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|