C29H28N2O3 — CID 126234395
(Z)-2-cyano-3-(3-methoxy-4-phenylmethoxy-5-prop-2-enylphenyl)-N-[(1R)-1-phenylethyl]prop-2-enamide (PubChem CID 126234395) has the molecular formula C29H28N2O3 and a molecular weight of 452.55 g/mol. Its IUPAC name is (Z)-2-cyano-3-(3-methoxy-4-phenylmethoxy-5-prop-2-enylphenyl)-N-[(1R)-1-phenylethyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(3-methoxy-4-phenylmethoxy-5-prop-2-enylphenyl)-N-[(1R)-1-phenylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 126234395 |
| Molecular Formula | C29H28N2O3 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | (Z)-2-cyano-3-(3-methoxy-4-phenylmethoxy-5-prop-2-enylphenyl)-N-[(1R)-1-phenylethyl]prop-2-enamide |
| SMILES | C=CCc1cc(/C=C(/C#N)C(=O)N[C@H](C)c2ccccc2)cc(OC)c1OCc1ccccc1 |
| InChI | InChI=1S/C29H28N2O3/c1-4-11-25-16-23(18-27(33-3)28(25)34-20-22-12-7-5-8-13-22)17-26(19-30)29(32)31-21(2)24-14-9-6-10-15-24/h4-10,12-18,21H,1,11,20H2,2-3H3,(H,31,32)/b26-17-/t21-/m1/s1 |
| InChIKey | VVBZLBLMAKUETD-XOASYVKCSA-N |
| XLogP | 5.79 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|