C26H19BrClN3O2 — CID 126245367
(Z)-3-[3-bromo-5-chloro-4-[(2-cyanophenyl)methoxy]phenyl]-2-cyano-N-[(1R)-1-phenylethyl]prop-2-enamide (PubChem CID 126245367) has the molecular formula C26H19BrClN3O2 and a molecular weight of 520.81 g/mol. Its IUPAC name is (Z)-3-[3-bromo-5-chloro-4-[(2-cyanophenyl)methoxy]phenyl]-2-cyano-N-[(1R)-1-phenylethyl]prop-2-enamide.
| Compound Name | (Z)-3-[3-bromo-5-chloro-4-[(2-cyanophenyl)methoxy]phenyl]-2-cyano-N-[(1R)-1-phenylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 126245367 |
| Molecular Formula | C26H19BrClN3O2 |
| Molecular Weight | 520.81 g/mol |
| Exact Mass | 519.03 |
| IUPAC Name | (Z)-3-[3-bromo-5-chloro-4-[(2-cyanophenyl)methoxy]phenyl]-2-cyano-N-[(1R)-1-phenylethyl]prop-2-enamide |
| SMILES | C[C@@H](NC(=O)/C(C#N)=C\c1cc(Cl)c(OCc2ccccc2C#N)c(Br)c1)c1ccccc1 |
| InChI | InChI=1S/C26H19BrClN3O2/c1-17(19-7-3-2-4-8-19)31-26(32)22(15-30)11-18-12-23(27)25(24(28)13-18)33-16-21-10-6-5-9-20(21)14-29/h2-13,17H,16H2,1H3,(H,31,32)/b22-11-/t17-/m1/s1 |
| InChIKey | OTCCALDZXRTMJR-FIJRTHIRSA-N |
| XLogP | 6.34 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.81 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|