C15H15Cl3N2O2 — CID 74089696
3-(3,5-dichloro-4-hydroxyphenyl)-2-(piperidine-1-carbonyl)prop-2-enenitrile;hydrochloride (PubChem CID 74089696) has the molecular formula C15H15Cl3N2O2 and a molecular weight of 361.66 g/mol. Its IUPAC name is 3-(3,5-dichloro-4-hydroxyphenyl)-2-(piperidine-1-carbonyl)prop-2-enenitrile;hydrochloride.
| Compound Name | 3-(3,5-dichloro-4-hydroxyphenyl)-2-(piperidine-1-carbonyl)prop-2-enenitrile;hydrochloride |
|---|---|
| PubChem CID | 74089696 |
| Molecular Formula | C15H15Cl3N2O2 |
| Molecular Weight | 361.66 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | 3-(3,5-dichloro-4-hydroxyphenyl)-2-(piperidine-1-carbonyl)prop-2-enenitrile;hydrochloride |
| SMILES | Cl.N#CC(=Cc1cc(Cl)c(O)c(Cl)c1)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C15H14Cl2N2O2.ClH/c16-12-7-10(8-13(17)14(12)20)6-11(9-18)15(21)19-4-2-1-3-5-19;/h6-8,20H,1-5H2;1H |
| InChIKey | GHSSMYVFJYDLBY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.66 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|