C20H17ClFN3O3 — CID 9341037
(E)-3-(3-chloro-4,5-dihydroxyphenyl)-2-[4-(2-fluorophenyl)piperazine-1-carbonyl]prop-2-enenitrile (PubChem CID 9341037) has the molecular formula C20H17ClFN3O3 and a molecular weight of 401.83 g/mol. Its IUPAC name is (E)-3-(3-chloro-4,5-dihydroxyphenyl)-2-[4-(2-fluorophenyl)piperazine-1-carbonyl]prop-2-enenitrile.
| Compound Name | (E)-3-(3-chloro-4,5-dihydroxyphenyl)-2-[4-(2-fluorophenyl)piperazine-1-carbonyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 9341037 |
| Molecular Formula | C20H17ClFN3O3 |
| Molecular Weight | 401.83 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | (E)-3-(3-chloro-4,5-dihydroxyphenyl)-2-[4-(2-fluorophenyl)piperazine-1-carbonyl]prop-2-enenitrile |
| SMILES | N#C/C(=C\c1cc(O)c(O)c(Cl)c1)C(=O)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C20H17ClFN3O3/c21-15-10-13(11-18(26)19(15)27)9-14(12-23)20(28)25-7-5-24(6-8-25)17-4-2-1-3-16(17)22/h1-4,9-11,26-27H,5-8H2/b14-9+ |
| InChIKey | LXNIQOUBSNRPFW-NTEUORMPSA-N |
| XLogP | 3.15 |
| TPSA | 87.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.83 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|