C23H20ClN3O3 — CID 126372411
2-[[2-chloro-4-[(E)-2-cyano-3-oxo-3-pyrrolidin-1-ylprop-1-enyl]-6-methoxyphenoxy]methyl]benzonitrile (PubChem CID 126372411) has the molecular formula C23H20ClN3O3 and a molecular weight of 421.88 g/mol. Its IUPAC name is 2-[[2-chloro-4-[(E)-2-cyano-3-oxo-3-pyrrolidin-1-ylprop-1-enyl]-6-methoxyphenoxy]methyl]benzonitrile.
| Compound Name | 2-[[2-chloro-4-[(E)-2-cyano-3-oxo-3-pyrrolidin-1-ylprop-1-enyl]-6-methoxyphenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126372411 |
| Molecular Formula | C23H20ClN3O3 |
| Molecular Weight | 421.88 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 2-[[2-chloro-4-[(E)-2-cyano-3-oxo-3-pyrrolidin-1-ylprop-1-enyl]-6-methoxyphenoxy]methyl]benzonitrile |
| SMILES | COc1cc(/C=C(\C#N)C(=O)N2CCCC2)cc(Cl)c1OCc1ccccc1C#N |
| InChI | InChI=1S/C23H20ClN3O3/c1-29-21-12-16(10-19(14-26)23(28)27-8-4-5-9-27)11-20(24)22(21)30-15-18-7-3-2-6-17(18)13-25/h2-3,6-7,10-12H,4-5,8-9,15H2,1H3/b19-10+ |
| InChIKey | FORJGPDTMNFUQY-VXLYETTFSA-N |
| XLogP | 4.33 |
| TPSA | 86.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.88 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|