C28H24Cl3N3O3 — CID 124534237
(Z)-3-[3-chloro-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-2-(4-phenylpiperazine-1-carbonyl)prop-2-enenitrile (PubChem CID 124534237) has the molecular formula C28H24Cl3N3O3 and a molecular weight of 556.88 g/mol. Its IUPAC name is (Z)-3-[3-chloro-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-2-(4-phenylpiperazine-1-carbonyl)prop-2-enenitrile.
| Compound Name | (Z)-3-[3-chloro-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-2-(4-phenylpiperazine-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 124534237 |
| Molecular Formula | C28H24Cl3N3O3 |
| Molecular Weight | 556.88 g/mol |
| Exact Mass | 555.09 |
| IUPAC Name | (Z)-3-[3-chloro-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-2-(4-phenylpiperazine-1-carbonyl)prop-2-enenitrile |
| SMILES | COc1cc(/C=C(/C#N)C(=O)N2CCN(c3ccccc3)CC2)cc(Cl)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C28H24Cl3N3O3/c1-36-26-16-20(15-25(31)27(26)37-18-19-7-8-23(29)24(30)14-19)13-21(17-32)28(35)34-11-9-33(10-12-34)22-5-3-2-4-6-22/h2-8,13-16H,9-12,18H2,1H3/b21-13- |
| InChIKey | NPKDXKXPUSEUDD-BKUYFWCQSA-N |
| XLogP | 6.49 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.88 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|