C22H18Br2Cl2N2O4 — CID 126007002
(Z)-3-[2,3-dibromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-2-(morpholine-4-carbonyl)prop-2-enenitrile (PubChem CID 126007002) has the molecular formula C22H18Br2Cl2N2O4 and a molecular weight of 605.11 g/mol. Its IUPAC name is (Z)-3-[2,3-dibromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-2-(morpholine-4-carbonyl)prop-2-enenitrile.
| Compound Name | (Z)-3-[2,3-dibromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-2-(morpholine-4-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126007002 |
| Molecular Formula | C22H18Br2Cl2N2O4 |
| Molecular Weight | 605.11 g/mol |
| Exact Mass | 601.90 |
| IUPAC Name | (Z)-3-[2,3-dibromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-2-(morpholine-4-carbonyl)prop-2-enenitrile |
| SMILES | COc1cc(/C=C(/C#N)C(=O)N2CCOCC2)c(Br)c(Br)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H18Br2Cl2N2O4/c1-30-18-10-14(9-15(11-27)22(29)28-4-6-31-7-5-28)19(23)20(24)21(18)32-12-13-2-3-16(25)17(26)8-13/h2-3,8-10H,4-7,12H2,1H3/b15-9- |
| InChIKey | YTGYLLBEOUJQFL-DHDCSXOGSA-N |
| XLogP | 5.87 |
| TPSA | 71.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.11 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|