C26H20Br2Cl2N2O3 — CID 126000122
(Z)-2-cyano-3-[2,3-dibromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-N-(3,4-dimethylphenyl)prop-2-enamide (PubChem CID 126000122) has the molecular formula C26H20Br2Cl2N2O3 and a molecular weight of 639.17 g/mol. Its IUPAC name is (Z)-2-cyano-3-[2,3-dibromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-N-(3,4-dimethylphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[2,3-dibromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-N-(3,4-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126000122 |
| Molecular Formula | C26H20Br2Cl2N2O3 |
| Molecular Weight | 639.17 g/mol |
| Exact Mass | 635.92 |
| IUPAC Name | (Z)-2-cyano-3-[2,3-dibromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]-N-(3,4-dimethylphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C(/C#N)C(=O)Nc2ccc(C)c(C)c2)c(Br)c(Br)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C26H20Br2Cl2N2O3/c1-14-4-6-19(8-15(14)2)32-26(33)18(12-31)10-17-11-22(34-3)25(24(28)23(17)27)35-13-16-5-7-20(29)21(30)9-16/h4-11H,13H2,1-3H3,(H,32,33)/b18-10- |
| InChIKey | DNAZDUDDNQSWMZ-ZDLGFXPLSA-N |
| XLogP | 8.27 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.17 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|