C19H16Br2N2O3 — CID 41270329
2-cyano-3-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-N-(4-ethylphenyl)prop-2-enamide (PubChem CID 41270329) has the molecular formula C19H16Br2N2O3 and a molecular weight of 480.16 g/mol. Its IUPAC name is 2-cyano-3-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-N-(4-ethylphenyl)prop-2-enamide.
| Compound Name | 2-cyano-3-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-N-(4-ethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 41270329 |
| Molecular Formula | C19H16Br2N2O3 |
| Molecular Weight | 480.16 g/mol |
| Exact Mass | 477.95 |
| IUPAC Name | 2-cyano-3-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-N-(4-ethylphenyl)prop-2-enamide |
| SMILES | CCc1ccc(NC(=O)C(C#N)=Cc2cc(OC)c(O)c(Br)c2Br)cc1 |
| InChI | InChI=1S/C19H16Br2N2O3/c1-3-11-4-6-14(7-5-11)23-19(25)13(10-22)8-12-9-15(26-2)18(24)17(21)16(12)20/h4-9,24H,3H2,1-2H3,(H,23,25) |
| InChIKey | DUSXPOPSIJDZRN-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.16 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|