C18H13Br2ClN2O3 — CID 21234624
(E)-N-(3-chloro-4-methylphenyl)-2-cyano-3-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)prop-2-enamide (PubChem CID 21234624) has the molecular formula C18H13Br2ClN2O3 and a molecular weight of 500.57 g/mol. Its IUPAC name is (E)-N-(3-chloro-4-methylphenyl)-2-cyano-3-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(3-chloro-4-methylphenyl)-2-cyano-3-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 21234624 |
| Molecular Formula | C18H13Br2ClN2O3 |
| Molecular Weight | 500.57 g/mol |
| Exact Mass | 497.90 |
| IUPAC Name | (E)-N-(3-chloro-4-methylphenyl)-2-cyano-3-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C(\C#N)C(=O)Nc2ccc(C)c(Cl)c2)c(Br)c(Br)c1O |
| InChI | InChI=1S/C18H13Br2ClN2O3/c1-9-3-4-12(7-13(9)21)23-18(25)11(8-22)5-10-6-14(26-2)17(24)16(20)15(10)19/h3-7,24H,1-2H3,(H,23,25)/b11-5+ |
| InChIKey | IBTCLLZHLHZHMZ-VZUCSPMQSA-N |
| XLogP | 5.43 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.57 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|