C18H14Br2N2O3 — CID 18530560
(Z)-2-cyano-3-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-N-(3-methylphenyl)prop-2-enamide (PubChem CID 18530560) has the molecular formula C18H14Br2N2O3 and a molecular weight of 466.13 g/mol. Its IUPAC name is (Z)-2-cyano-3-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-N-(3-methylphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-N-(3-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 18530560 |
| Molecular Formula | C18H14Br2N2O3 |
| Molecular Weight | 466.13 g/mol |
| Exact Mass | 463.94 |
| IUPAC Name | (Z)-2-cyano-3-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-N-(3-methylphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C(/C#N)C(=O)Nc2cccc(C)c2)c(Br)c(Br)c1O |
| InChI | InChI=1S/C18H14Br2N2O3/c1-10-4-3-5-13(6-10)22-18(24)12(9-21)7-11-8-14(25-2)17(23)16(20)15(11)19/h3-8,23H,1-2H3,(H,22,24)/b12-7- |
| InChIKey | WPMFTRIJBJRUQJ-GHXNOFRVSA-N |
| XLogP | 4.78 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.13 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|