C18H14Cl2N2O — CID 4532791
2-cyano-3-(2,4-dichlorophenyl)-N-(4-ethylphenyl)prop-2-enamide (PubChem CID 4532791) has the molecular formula C18H14Cl2N2O and a molecular weight of 345.23 g/mol. Its IUPAC name is 2-cyano-3-(2,4-dichlorophenyl)-N-(4-ethylphenyl)prop-2-enamide.
| Compound Name | 2-cyano-3-(2,4-dichlorophenyl)-N-(4-ethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4532791 |
| Molecular Formula | C18H14Cl2N2O |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | 2-cyano-3-(2,4-dichlorophenyl)-N-(4-ethylphenyl)prop-2-enamide |
| SMILES | CCc1ccc(NC(=O)C(C#N)=Cc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C18H14Cl2N2O/c1-2-12-3-7-16(8-4-12)22-18(23)14(11-21)9-13-5-6-15(19)10-17(13)20/h3-10H,2H2,1H3,(H,22,23) |
| InChIKey | CZQJGAIBJWPUCN-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|