C20H19ClN2O — CID 4304434
N-(4-butylphenyl)-3-(2-chlorophenyl)-2-cyanoprop-2-enamide (PubChem CID 4304434) has the molecular formula C20H19ClN2O and a molecular weight of 338.84 g/mol. Its IUPAC name is N-(4-butylphenyl)-3-(2-chlorophenyl)-2-cyanoprop-2-enamide.
| Compound Name | N-(4-butylphenyl)-3-(2-chlorophenyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 4304434 |
| Molecular Formula | C20H19ClN2O |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | N-(4-butylphenyl)-3-(2-chlorophenyl)-2-cyanoprop-2-enamide |
| SMILES | CCCCc1ccc(NC(=O)C(C#N)=Cc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C20H19ClN2O/c1-2-3-6-15-9-11-18(12-10-15)23-20(24)17(14-22)13-16-7-4-5-8-19(16)21/h4-5,7-13H,2-3,6H2,1H3,(H,23,24) |
| InChIKey | BNLXSCRYSZUVDH-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|