C23H14Br3Cl2NO2 — CID 126002366
(E)-2-(4-bromophenyl)-3-[2,3-dibromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]prop-2-enenitrile (PubChem CID 126002366) has the molecular formula C23H14Br3Cl2NO2 and a molecular weight of 646.99 g/mol. Its IUPAC name is (E)-2-(4-bromophenyl)-3-[2,3-dibromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]prop-2-enenitrile.
| Compound Name | (E)-2-(4-bromophenyl)-3-[2,3-dibromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 126002366 |
| Molecular Formula | C23H14Br3Cl2NO2 |
| Molecular Weight | 646.99 g/mol |
| Exact Mass | 642.80 |
| IUPAC Name | (E)-2-(4-bromophenyl)-3-[2,3-dibromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]prop-2-enenitrile |
| SMILES | COc1cc(/C=C(/C#N)c2ccc(Br)cc2)c(Br)c(Br)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H14Br3Cl2NO2/c1-30-20-10-15(9-16(11-29)14-3-5-17(24)6-4-14)21(25)22(26)23(20)31-12-13-2-7-18(27)19(28)8-13/h2-10H,12H2,1H3/b16-9- |
| InChIKey | NBFXDSOBLMXNLO-SXGWCWSVSA-N |
| XLogP | 8.93 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.99 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|