C22H14Br4Cl2N2O4 — CID 126008222
3,5-dibromo-N-[(Z)-[2,3-dibromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-4-hydroxybenzamide (PubChem CID 126008222) has the molecular formula C22H14Br4Cl2N2O4 and a molecular weight of 760.89 g/mol. Its IUPAC name is 3,5-dibromo-N-[(Z)-[2,3-dibromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-4-hydroxybenzamide.
| Compound Name | 3,5-dibromo-N-[(Z)-[2,3-dibromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 126008222 |
| Molecular Formula | C22H14Br4Cl2N2O4 |
| Molecular Weight | 760.89 g/mol |
| Exact Mass | 755.71 |
| IUPAC Name | 3,5-dibromo-N-[(Z)-[2,3-dibromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-4-hydroxybenzamide |
| SMILES | COc1cc(/C=N\NC(=O)c2cc(Br)c(O)c(Br)c2)c(Br)c(Br)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H14Br4Cl2N2O4/c1-33-17-7-12(8-29-30-22(32)11-5-13(23)20(31)14(24)6-11)18(25)19(26)21(17)34-9-10-2-3-15(27)16(28)4-10/h2-8,31H,9H2,1H3,(H,30,32)/b29-8- |
| InChIKey | WTSXNLLGZIVOAX-HYYKAVFWSA-N |
| XLogP | 8.10 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.89 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|